CAS 71033-27-7
:2,2'-[ethane-1,2-diylbis(oxy)]bis(tetrahydro-2H-pyran)
Description:
2,2'-[Ethane-1,2-diylbis(oxy)]bis(tetrahydro-2H-pyran), with the CAS number 71033-27-7, is a chemical compound characterized by its unique structure that includes two tetrahydro-2H-pyran units linked by an ethane-1,2-diyl group. This compound features ether linkages, which contribute to its potential solubility in organic solvents. The tetrahydro-2H-pyran moiety is a six-membered cyclic ether, known for its stability and ability to participate in various chemical reactions, including nucleophilic substitutions and ring-opening reactions. The presence of the ethane-1,2-diyl group introduces flexibility into the molecule, potentially affecting its physical properties such as boiling point and melting point. Additionally, the compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in medicinal chemistry. Overall, its unique structure and functional groups suggest a range of potential applications in fields such as pharmaceuticals, materials science, and organic synthesis.
Formula:C12H22O4
InChI:InChI=1/C12H22O4/c1-3-7-13-11(5-1)15-9-10-16-12-6-2-4-8-14-12/h11-12H,1-10H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
THP-PEG1-THP
CAS:THP-PEG1-THP is a PROTAC linker belonging to the PEG category and is utilized in the synthesis of PROTAC molecules.Formula:C12H22O4Molecular weight:230.30
