CAS 710339-81-4
:6-chloro-1-(3-chlorophenyl)hexan-1-one
Description:
6-Chloro-1-(3-chlorophenyl)hexan-1-one is an organic compound characterized by its ketone functional group and the presence of chlorine substituents. The molecular structure features a hexanone backbone, with a chlorine atom at the sixth carbon and a phenyl group substituted at the first carbon, specifically a 3-chlorophenyl group. This compound is likely to exhibit moderate to high lipophilicity due to its hydrophobic hydrocarbon chain and aromatic ring, which can influence its solubility in organic solvents. The presence of chlorine atoms may impart unique reactivity and stability characteristics, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the compound's structure suggests potential for biological activity, which could be explored in medicinal chemistry. Safety and handling precautions should be observed due to the presence of halogenated compounds, which may pose environmental and health risks. Overall, 6-chloro-1-(3-chlorophenyl)hexan-1-one represents a versatile chemical entity with potential applications in synthetic organic chemistry.
Formula:C12H14Cl2O
InChI:InChI=1/C12H14Cl2O/c13-8-3-1-2-7-12(15)10-5-4-6-11(14)9-10/h4-6,9H,1-3,7-8H2
SMILES:C(CCC(=O)c1cccc(c1)Cl)CCCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.