CymitQuimica logo

CAS 710348-22-4

:

N-(3-Bromo-2-methylphenyl)methanesulfonamide

Description:
N-(3-Bromo-2-methylphenyl)methanesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group attached to a substituted aromatic ring. The compound features a bromine atom and a methyl group on the phenyl ring, which influence its chemical reactivity and physical properties. Typically, sulfonamides exhibit good solubility in polar solvents due to their ability to form hydrogen bonds, while the presence of the bromine atom can enhance the compound's electrophilicity. This compound may be of interest in medicinal chemistry, particularly for its potential biological activity, as sulfonamides are known for their antibacterial properties. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the presence of the bromine substituent can also affect the compound's stability and reactivity under different conditions. Overall, N-(3-Bromo-2-methylphenyl)methanesulfonamide represents a unique structure with potential applications in pharmaceuticals and organic synthesis.
Formula:C8H10BrNO2S
InChI:InChI=1S/C8H10BrNO2S/c1-6-7(9)4-3-5-8(6)10-13(2,11)12/h3-5,10H,1-2H3
InChI key:InChIKey=JUULZMZSYKEVKS-UHFFFAOYSA-N
SMILES:N(S(C)(=O)=O)C1=C(C)C(Br)=CC=C1
Synonyms:
  • N-(3-Bromo-2-methylphenyl)methanesulfonamide
  • Methanesulfonamide, N-(3-bromo-2-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.