CAS 710348-42-8

Boronic acid, (2,3-dihydro-2-oxo-5-benzoxazolyl)-

Description:

Boronic acid, specifically (2,3-dihydro-2-oxo-5-benzoxazolyl)-, is a compound characterized by the presence of a boronic acid functional group, which typically features a boron atom bonded to a hydroxyl group and an organic moiety. This particular compound is notable for its benzoxazole ring, which contributes to its unique chemical properties, including potential applications in medicinal chemistry and organic synthesis. The presence of the dihydro-2-oxo structure suggests that it may exhibit reactivity typical of carbonyl compounds, allowing for various chemical transformations. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them useful in the development of sensors and in drug design. Additionally, the compound may exhibit specific solubility characteristics and stability under various conditions, which are important for its practical applications. Overall, this boronic acid derivative is of interest in research due to its potential utility in various chemical and biological contexts.

Formula: C₇H₆BNO₄

InChI: InChI=1S/C7H6BNO4/c10-7-9-5-3-4(8(11)12)1-2-6(5)13-7/h1-3,11-12H,(H,9,10)

InChI key: InChIKey=WWGUKCACGZLIHO-UHFFFAOYSA-N

SMILES: B(O)(O)C=1C=C2C(=CC1)OC(=O)N2

Synonyms:

• 2-Oxo-2,3-Dihydrobenzooxazole-5-boronic acid
• Boronic acid, (2,3-dihydro-2-oxo-5-benzoxazolyl)-
• (2-Hydroxy-1,3-benzoxazol-5-yl)boronic acid
• (2-Oxo-2,3-dihydro-1,3-benzoxazol-5-yl)boronic acid

2-oxo-3H-1,3-benzoxazol-5-yl)boronic acid

CAS: 710348-42-8

Formula: C₇H₆BNO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 178.9378

Ref: IN-DA01EX1Z

(2-Oxo-2,3-dihydrobenzo[d]oxazol-5-yl)boronic acid

CAS: 710348-42-8

(2-Oxo-2,3-dihydrobenzo[d]oxazol-5-yl)boronic acid

Purity: 98%

Molecular weight: 178.94g/mol

Ref: 54-OR1001502

(2-Oxo-2,3-dihydrobenzo[d]oxazol-5-yl)boronic acid

CAS: 710348-42-8

Purity: 98%

Molecular weight: 178.9400024

Ref: 10-F690755