CAS 71035-06-8
:dimethyl (1R,4aR,7R,7aR)-1-(beta-D-glucopyranosyloxy)-5-oxo-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4,7-dicarboxylate
Description:
Dimethyl (1R,4aR,7R,7aR)-1-(beta-D-glucopyranosyloxy)-5-oxo-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4,7-dicarboxylate, with CAS number 71035-06-8, is a complex organic compound characterized by its unique bicyclic structure and multiple functional groups. This substance features a glucopyranosyl moiety, which indicates it is a glycoside, suggesting potential biological activity or interaction with biological systems. The presence of dicarboxylate groups implies it may participate in various chemical reactions, including esterification and acid-base reactions. The stereochemistry, denoted by the (1R,4aR,7R,7aR) configuration, indicates specific spatial arrangements of atoms that can influence the compound's reactivity and interactions. Additionally, the dimethyl ester functionality suggests it may exhibit solubility in organic solvents and could be hydrolyzed to release the corresponding carboxylic acids. Overall, this compound's structural complexity and functional groups may contribute to its potential applications in pharmaceuticals, biochemistry, or as a synthetic intermediate in organic chemistry.
Formula:C18H24O12
InChI:InChI=1/C18H24O12/c1-26-15(24)6-3-8(20)10-7(16(25)27-2)5-28-17(11(6)10)30-18-14(23)13(22)12(21)9(4-19)29-18/h5-6,9-14,17-19,21-23H,3-4H2,1-2H3/t6-,9-,10-,11+,12-,13+,14-,17-,18+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Griselinoside
CAS:Griselinoside is a natural product of Toricellia, Toricelliaceae.Formula:C18H24O12Purity:98%Color and Shape:SolidMolecular weight:432.378Griselinoside
CAS:Griselinoside is a natural product that is classified as a diterpenoid saponin, which is isolated primarily from the plant Griselinia littoralis. This compound is derived from a species belonging to the Cornaceae family, recognized for synthesizing various biologically active saponins. Griselinoside’s mode of action involves interacting with cell membranes, impacting processes such as permeability and signaling pathways through its amphiphilic structure, formed by the triterpenoid core and attached sugar moieties. This interaction can lead to alterations in cellular environments, providing multiple pathways for potential therapeutic effects.Formula:C18H24O12Purity:Min. 95%Molecular weight:432.4 g/mol


