CAS 710351-86-3
:4-Fluoro-3-(1-methylethyl)benzenamine
Description:
4-Fluoro-3-(1-methylethyl)benzenamine, also known by its CAS number 710351-86-3, is an organic compound characterized by the presence of a fluorine atom and an isopropyl group attached to a benzene ring. This compound features an amine functional group, which contributes to its basicity and potential reactivity in various chemical reactions. The fluorine substituent can influence the compound's electronic properties, potentially enhancing its reactivity or altering its interaction with biological systems. The isopropyl group adds steric bulk, which may affect the compound's solubility and overall stability. Typically, such compounds are of interest in pharmaceutical chemistry and materials science due to their unique properties. They may exhibit specific biological activities or serve as intermediates in the synthesis of more complex molecules. Safety data should be consulted for handling and usage, as amines can be hazardous. Overall, 4-Fluoro-3-(1-methylethyl)benzenamine represents a class of compounds with diverse applications in research and industry.
Formula:C9H12FN
InChI:InChI=1S/C9H12FN/c1-6(2)8-5-7(11)3-4-9(8)10/h3-6H,11H2,1-2H3
InChI key:InChIKey=AEWMVMHKUNCBIR-UHFFFAOYSA-N
SMILES:C(C)(C)C1=C(F)C=CC(N)=C1
Synonyms:- 3-Isopropyl-4-fluoroaniline
- 4-Fluoro-3-(1-methylethyl)benzenamine
- 4-Fluoro-3-isopropylaniline
- Benzenamine, 4-fluoro-3-(1-methylethyl)-
- 4-fluoro-3-(propan-2-yl)aniline
- Benzenamine, 4-fluoro-3-(1-methylethyl)- (9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
