CAS 71046-22-5

7-Aminobicyclo[2.2.1]heptane-7-carboxylic acid

Description:

7-Aminobicyclo[2.2.1]heptane-7-carboxylic acid, also known as norbornane-2-carboxylic acid, is a bicyclic compound characterized by its unique bicyclo[2.2.1]heptane structure, which consists of a seven-membered ring with two fused cyclopentane rings. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the same carbon atom, specifically at the 7-position of the bicyclic framework. The presence of these functional groups imparts both basic and acidic properties, making it a versatile intermediate in organic synthesis. The compound is typically a white to off-white solid and is soluble in polar solvents due to its functional groups. Its applications may include use in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The compound's unique structure and functional groups contribute to its reactivity and potential applications in various chemical reactions, including amide formation and carboxylation reactions.

Formula: C₈H₁₃NO₂

InChI: InChI=1S/C8H13NO2/c9-8(7(10)11)5-1-2-6(8)4-3-5/h5-6H,1-4,9H2,(H,10,11)

InChI key: InChIKey=FJSBTBMXYJSJAT-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(N)C2CCC1CC2

Synonyms:

• 7-Aminobicyclo[2.2.1]heptane-7-carboxylic acid
• Bicyclo[2.2.1]heptane-7-carboxylic acid, 7-amino-