CAS 71048-42-5
:7-(benzyloxy)-3,4-dihydronaphthalen-2(1H)-one
Description:
7-(Benzyloxy)-3,4-dihydronaphthalen-2(1H)-one, with the CAS number 71048-42-5, is an organic compound characterized by its naphthalene structure, which features a ketone functional group and a benzyloxy substituent. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic naphthalene core. The presence of the benzyloxy group enhances its lipophilicity, potentially influencing its biological activity and interactions. The compound may be of interest in synthetic organic chemistry and medicinal chemistry, particularly for its potential applications in drug development or as an intermediate in the synthesis of more complex molecules. Its chemical properties, such as melting point, boiling point, and reactivity, would be influenced by the specific functional groups present and their arrangement within the molecular structure. As with many organic compounds, safety data should be consulted for handling and usage.
Formula:C17H16O2
InChI:InChI=1/C17H16O2/c18-16-8-6-14-7-9-17(11-15(14)10-16)19-12-13-4-2-1-3-5-13/h1-5,7,9,11H,6,8,10,12H2
SMILES:c1ccc(cc1)COc1ccc2CCC(=O)Cc2c1
Synonyms:- 2(1H)-naphthalenone, 3,4-dihydro-7-(phenylmethoxy)-
- 7-(Benzyloxy)-3,4-dihydronaphthalen-2(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.