CAS 71050-40-3

4-Methoxythiophene-3-carboxylic acid

Description:

4-Methoxythiophene-3-carboxylic acid is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. The presence of a methoxy group (-OCH3) at the 4-position and a carboxylic acid group (-COOH) at the 3-position contributes to its chemical reactivity and solubility properties. This compound is typically a white to light yellow solid and is soluble in polar solvents such as water and alcohols due to the polar nature of the carboxylic acid group. It exhibits acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Additionally, the methoxy group can influence the electronic properties of the thiophene ring, potentially enhancing its reactivity in electrophilic substitution reactions. 4-Methoxythiophene-3-carboxylic acid is of interest in organic synthesis and materials science, particularly in the development of conductive polymers and other advanced materials.

Formula: C₆H₆O₃S

InChI: InChI=1/C6H6O3S/c1-9-5-3-10-2-4(5)6(7)8/h2-3H,1H3,(H,7,8)

SMILES: COc1cscc1C(=O)O

Synonyms:

• 3-Thiophenecarboxylic Acid, 4-Methoxy-

4-METHOXYTHIOPHENE-3-CARBOXYLIC ACID

CAS: 71050-40-3

Formula: C₆H₆O₃S

Purity: 96%

Color and Shape: Solid

Molecular weight: 158.1750

Ref: IN-DA005OZP

4-Methoxythiophene-3-carboxylic acid

CAS: 71050-40-3

4-Methoxythiophene-3-carboxylic acid

Formula: C₆H₆O₃S

Purity: ≥95%

Color and Shape: light brown powder

Molecular weight: 158.18g/mol

Ref: 54-OR25041

4-Methoxythiophene-3-carboxylic acid

CAS: 71050-40-3

Formula: C₆H₆O₃S

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 158.17

Ref: 10-F020163