CAS 71054-77-8

[(1,1-dioxido-1,2-benzothiazol-3-yl)amino]acetate

Description:

The chemical substance known as [(1,1-dioxido-1,2-benzothiazol-3-yl)amino]acetate, with the CAS number 71054-77-8, is a compound that features a benzothiazole moiety, which is characterized by a fused benzene and thiazole ring. This compound contains a dioxido group, indicating the presence of two oxygen atoms bonded to the sulfur atom in the thiazole ring, contributing to its reactivity and potential biological activity. The aminoacetate portion suggests that it has an amino group attached to an acetate moiety, which may enhance its solubility in polar solvents and facilitate interactions with biological systems. The presence of both the benzothiazole and aminoacetate functionalities may impart unique properties, such as potential antimicrobial or anticancer activities, making it of interest in pharmaceutical research. Additionally, the compound's stability, solubility, and reactivity can be influenced by its molecular structure, which may affect its applications in various fields, including medicinal chemistry and material science.

Formula: C₉H₇N₂O₄S

InChI: InChI=1/C9H8N2O4S/c12-8(13)5-10-9-6-3-1-2-4-7(6)16(14,15)11-9/h1-4H,5H2,(H,10,11)(H,12,13)/p-1

SMILES: c1ccc2c(c1)C(=NCC(=O)[O-])NS2(=O)=O

2-[(1,1-Dioxo-1,2-benzothiazol-3-yl)amino]acetic acid

CAS: 71054-77-8

Versatile small molecule scaffold

Formula: C₉H₈N₂O₄S

Purity: Min. 95%

Molecular weight: 240.24 g/mol

Ref: 3D-WCA05477