CAS 71057-15-3

4-(ethylsulfanyl)butanoic acid

Description:

4-(Ethylsulfanyl)butanoic acid, with the CAS number 71057-15-3, is an organic compound characterized by the presence of a butanoic acid backbone substituted with an ethylsulfanyl group at the fourth carbon position. This compound features a carboxylic acid functional group (-COOH), which imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The ethylsulfanyl group contributes to the compound's unique reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of sulfur in the ethylsulfanyl moiety can influence the compound's polarity and solubility in different solvents. Additionally, the structure suggests potential for biological activity, making it of interest in pharmaceutical research. Its physical properties, such as melting point, boiling point, and solubility, would typically depend on the specific molecular interactions and the presence of functional groups. Overall, 4-(ethylsulfanyl)butanoic acid is a versatile compound with potential applications in various fields of chemistry and biochemistry.

Formula: C₆H₁₂O₂S

InChI: InChI=1/C6H12O2S/c1-2-9-5-3-4-6(7)8/h2-5H2,1H3,(H,7,8)