CAS 71058-34-9
:4-(2-Methoxy-5-methylphenyl)-3-thiosemicarbezide
Description:
4-(2-Methoxy-5-methylphenyl)-3-thiosemicarbazide is an organic compound characterized by its thiosemicarbazide functional group, which is known for its diverse biological activities. This compound features a phenyl ring substituted with a methoxy group and a methyl group, contributing to its lipophilicity and potential interactions with biological targets. The thiosemicarbazide moiety is recognized for its ability to form coordination complexes with metal ions, which can enhance its pharmacological properties. The presence of the methoxy and methyl substituents can influence the compound's solubility, stability, and reactivity. Additionally, thiosemicarbazides are often studied for their antimicrobial, anticancer, and anti-inflammatory activities, making this compound of interest in medicinal chemistry. Its CAS number, 71058-34-9, allows for precise identification in chemical databases and literature. Overall, this compound exemplifies the structural diversity and potential therapeutic applications of thiosemicarbazides in drug development.
Formula:C9H13N3OS
InChI:InChI=1/C9H13N3OS/c1-6-3-4-8(13-2)7(5-6)11-9(14)12-10/h3-5H,10H2,1-2H3,(H2,11,12,14)
SMILES:Cc1ccc(c(c1)N=C(NN)S)OC
Synonyms:- N-(2-methoxy-5-methylphenyl)hydrazinecarbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
4-(2-Methoxy-5-methylphenyl)-3-thiosemicarbazide
CAS:Formula:C9H13N3OSColor and Shape:SolidMolecular weight:211.28404-(2-Methoxy-5-methylphenyl)-3-thiosemicarbazide
CAS:<p>4-(2-Methoxy-5-methylphenyl)-3-thiosemicarbazide</p>Molecular weight:211.28402g/mol4-(2-Methoxy-5-methylphenyl)-3-thiosemicarbazide
CAS:Formula:C9H13N3OSColor and Shape:SolidMolecular weight:211.28



