CAS 71058-43-0

3-Amino-2-methyl-4-pyridinecarbonitrile

Description:

3-Amino-2-methyl-4-pyridinecarbonitrile, with the CAS number 71058-43-0, is an organic compound characterized by its pyridine ring structure, which includes an amino group and a cyano group. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The methyl group at the second position of the pyridine ring contributes to its hydrophobic character, while the cyano group at the fourth position enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The presence of both amino and cyano functional groups allows for diverse applications in medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound's properties may include moderate stability under standard conditions, but it should be handled with care due to potential toxicity associated with the cyano group. Overall, 3-Amino-2-methyl-4-pyridinecarbonitrile is a versatile compound with significant implications in chemical research and industry.

Formula: C₇H₇N₃

InChI: InChI=1S/C7H7N3/c1-5-7(9)6(4-8)2-3-10-5/h2-3H,9H2,1H3

InChI key: InChIKey=BDWOUODZXCPTAF-UHFFFAOYSA-N

SMILES: C(#N)C=1C(N)=C(C)N=CC1

Synonyms:

• 3-Amino-2-methyl-4-pyridinecarbonitrile
• 4-Pyridinecarbonitrile, 3-amino-2-methyl-