CymitQuimica logo

CAS 71058-61-2

:

3-(Chloromethyl)-5-isoxazolemethanol

Description:
3-(Chloromethyl)-5-isoxazolemethanol, with the CAS number 71058-61-2, is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This compound features a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. The presence of the hydroxymethyl group contributes to its solubility in polar solvents and may influence its biological activity. Typically, compounds like this may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The chloromethyl group can serve as a leaving group in nucleophilic substitution reactions, allowing for the synthesis of more complex molecules. Additionally, the isoxazole moiety is often associated with diverse biological activities, including antimicrobial and anti-inflammatory effects. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the chloromethyl group can pose hazards. Overall, 3-(Chloromethyl)-5-isoxazolemethanol is a versatile compound with potential applications in research and industry.
Formula:C5H6ClNO2
InChI:InChI=1S/C5H6ClNO2/c6-2-4-1-5(3-8)9-7-4/h1,8H,2-3H2
InChI key:InChIKey=LUVJOTYECLBJJC-UHFFFAOYSA-N
SMILES:C(Cl)C=1C=C(CO)ON1
Synonyms:
  • [3-(Chloromethyl)-1,2-oxazol-5-yl]methanol
  • 3-(Chloromethyl)-5-isoxazolemethanol
  • 5-Isoxazolemethanol, 3-(chloromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.