CAS 71058-85-0

(4R)-4-chloro-9-methyl-1,2,3,4-tetrahydroacridine

Description:

(4R)-4-chloro-9-methyl-1,2,3,4-tetrahydroacridine is a chemical compound characterized by its tetrahydroacridine structure, which consists of a fused bicyclic system containing both aromatic and aliphatic components. The presence of a chlorine atom at the 4-position and a methyl group at the 9-position contributes to its unique chemical properties and potential biological activity. This compound is often studied for its pharmacological applications, particularly in the context of neurochemistry and as a potential therapeutic agent for neurodegenerative diseases. Its stereochemistry, indicated by the (4R) designation, suggests that it has specific spatial arrangements that can influence its interaction with biological targets. The compound's solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Additionally, its molecular interactions may be influenced by the presence of functional groups, making it a subject of interest in medicinal chemistry and drug design. Overall, (4R)-4-chloro-9-methyl-1,2,3,4-tetrahydroacridine represents a significant compound for further research in various scientific fields.

Formula: C₁₄H₁₄ClN

InChI: InChI=1/C14H14ClN/c1-9-10-5-2-3-8-13(10)16-14-11(9)6-4-7-12(14)15/h2-3,5,8,12H,4,6-7H2,1H3/t12-/m1/s1

SMILES: Cc1c2ccccc2nc2c1CCC[C@H]2Cl

4-Chloro-9-methyl-1,2,3,4-tetrahydroacridine

CAS: 71058-85-0

Versatile small molecule scaffold

Formula: C₁₄H₁₅Cl₂N

Purity: Min. 95%

Molecular weight: 268.2 g/mol

Ref: 3D-WCA05885