CymitQuimica logo

CAS 71067-09-9

:

hexadecyl 4-hydroxybenzoate

Description:
Hexadecyl 4-hydroxybenzoate, with the CAS number 71067-09-9, is an ester derived from the reaction of hexadecyl alcohol and 4-hydroxybenzoic acid. This compound is characterized by its long hydrophobic hexadecyl chain, which contributes to its surfactant properties, making it useful in various applications, particularly in cosmetics and personal care products. It exhibits good solubility in organic solvents and is generally insoluble in water due to its hydrophobic nature. Hexadecyl 4-hydroxybenzoate also possesses antioxidant properties, which can help stabilize formulations by preventing oxidative degradation. Additionally, it may function as a preservative, providing antimicrobial activity. Its chemical structure includes a phenolic hydroxyl group, which can participate in hydrogen bonding, enhancing its compatibility with other ingredients in formulations. Overall, hexadecyl 4-hydroxybenzoate is valued for its emulsifying, stabilizing, and preservative qualities in various industrial applications.
Formula:C23H38O3
InChI:InChI=1/C23H38O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20-26-23(25)21-16-18-22(24)19-17-21/h16-19,24H,2-15,20H2,1H3
SMILES:CCCCCCCCCCCCCCCCOC(=O)c1ccc(cc1)O
Synonyms:
  • 4-Hydroxybenzoic acid hexadecyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.