CymitQuimica logo

CAS 7107-08-6

:

6-nitro-1,3-benzodioxol-5-yl acetate

Description:
6-Nitro-1,3-benzodioxol-5-yl acetate, with the CAS number 7107-08-6, is an organic compound characterized by its unique structure that includes a benzodioxole moiety and a nitro group. This compound typically appears as a pale yellow to light brown solid and is known for its aromatic properties. The presence of the nitro group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nitration and substitution processes. It is often utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. The acetate functional group enhances its solubility in organic solvents, facilitating its use in various applications. Additionally, the compound may exhibit biological activity, which warrants further investigation for potential therapeutic uses. As with many nitro compounds, it is essential to handle this substance with care due to its potential toxicity and environmental impact. Proper safety protocols should be followed when working with this chemical to mitigate any risks associated with its use.
Formula:C9H7NO6
InChI:InChI=1/C9H7NO6/c1-5(11)16-7-3-9-8(14-4-15-9)2-6(7)10(12)13/h2-3H,4H2,1H3
SMILES:CC(=O)Oc1cc2c(cc1N(=O)=O)OCO2
Synonyms:
  • 1,3-Benzodioxol-5-Ol, 6-Nitro-, Acetate (Ester)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.