CymitQuimica logo

CAS 7107-10-0

:

6-nitro-1,3-benzodioxol-5-ol

Description:
6-Nitro-1,3-benzodioxol-5-ol, with the CAS number 7107-10-0, is an organic compound characterized by its unique structure, which includes a benzodioxole core substituted with a nitro group and a hydroxyl group. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and organic synthesis. The presence of the nitro group contributes to its reactivity, making it a useful intermediate in the synthesis of other chemical entities. The hydroxyl group enhances its solubility in polar solvents, which can influence its behavior in chemical reactions. Additionally, the compound may exhibit biological activity, although specific biological properties would depend on the context of its use. Safety data should be consulted for handling and storage, as compounds with nitro groups can sometimes pose hazards. Overall, 6-nitro-1,3-benzodioxol-5-ol is a compound of interest in both academic and industrial chemistry due to its distinctive functional groups and potential reactivity.
Formula:C7H5NO5
InChI:InChI=1/C7H5NO5/c9-5-2-7-6(12-3-13-7)1-4(5)8(10)11/h1-2,9H,3H2
SMILES:c1c(c(cc2c1OCO2)O)N(=O)=O
Synonyms:
  • 1,3-Benzodioxol-5-Ol, 6-Nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.