CymitQuimica logo

CAS 71072-22-5

:

1-hexylpiperidin-4-one

Description:
1-Hexylpiperidin-4-one is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a hexyl substituent at the nitrogen atom of the piperidine ring and a ketone functional group at the 4-position. This structure imparts unique properties, including potential lipophilicity due to the long hydrocarbon chain, which can influence its solubility in organic solvents and biological membranes. The presence of the ketone group may also contribute to its reactivity, making it a candidate for various chemical reactions, including nucleophilic additions. 1-Hexylpiperidin-4-one is of interest in medicinal chemistry and material science, where it may serve as a precursor or intermediate in the synthesis of pharmaceuticals or other organic compounds. Its specific physical and chemical properties, such as boiling point, melting point, and reactivity, would typically be determined through experimental methods or detailed literature studies. As with any chemical substance, proper handling and safety precautions are essential due to potential hazards associated with its use.
Formula:C11H21NO
InChI:InChI=1/C11H21NO/c1-2-3-4-5-8-12-9-6-11(13)7-10-12/h2-10H2,1H3
SMILES:CCCCCCN1CCC(=O)CC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.