CymitQuimica logo

CAS 71077-37-7

:

4-(2-Methoxyethoxy)-1,3-benzenediamine

Description:
4-(2-Methoxyethoxy)-1,3-benzenediamine, with the CAS number 71077-37-7, is an organic compound characterized by its aromatic structure and the presence of two amine functional groups. This compound features a benzene ring substituted with a methoxyethoxy group, which enhances its solubility in organic solvents. The presence of the amine groups suggests that it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it useful in organic synthesis and potentially in the development of pharmaceuticals or agrochemicals. Its molecular structure indicates that it may exhibit properties such as moderate polarity and the ability to form hydrogen bonds, which can influence its reactivity and interactions with other substances. Additionally, the compound may have applications in materials science, particularly in the formulation of polymers or coatings, due to its functional groups that can facilitate cross-linking or bonding with other materials. Safety and handling precautions should be observed, as with any chemical, due to potential toxicity or reactivity.
Formula:C9H14N2O2
InChI:InChI=1S/C9H14N2O2/c1-12-4-5-13-9-3-2-7(10)6-8(9)11/h2-3,6H,4-5,10-11H2,1H3
InChI key:InChIKey=ZNBTUAAPXSCFBS-UHFFFAOYSA-N
SMILES:O(CCOC)C1=C(N)C=C(N)C=C1
Synonyms:
  • 1,3-Diamino-4-(2-methoxyethoxy)benzene
  • 4-(2-Methoxyethoxy)-1,3-benzenediamine
  • 1,3-Benzenediamine, 4-(2-methoxyethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.