
CAS 71082-37-6
:8-Methoxy-3-quinolinecarboxamide
Description:
8-Methoxy-3-quinolinecarboxamide, with the CAS number 71082-37-6, is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a methoxy group (-OCH3) at the 8-position and a carboxamide group (-C(=O)NH2) at the 3-position of the quinoline ring. The presence of these functional groups contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The methoxy group can enhance lipophilicity, potentially affecting the compound's solubility and permeability, while the carboxamide group may participate in hydrogen bonding, influencing its interactions with biological targets. 8-Methoxy-3-quinolinecarboxamide may exhibit various properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological effects would depend on further empirical studies. As with many quinoline derivatives, it may also display fluorescence properties, making it useful in various analytical applications. Proper handling and safety measures should be observed due to its chemical nature.
Formula:C11H10N2O2
InChI:InChI=1S/C11H10N2O2/c1-15-9-4-2-3-7-5-8(11(12)14)6-13-10(7)9/h2-6H,1H3,(H2,12,14)
InChI key:InChIKey=YQQVIOUUJOZMIO-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C(C=C(C(N)=O)C=N2)C=CC1
Synonyms:- 8-Methoxy-3-quinolinecarboxamide
- 3-Quinolinecarboxamide, 8-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.