CAS 71082-54-7

8-Chloroquinoline-3-carboxylic acid

Description:

8-Chloroquinoline-3-carboxylic acid is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features a chloro substituent at the 8-position and a carboxylic acid group at the 3-position, contributing to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The chloro group can influence the compound's electronic properties and reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. 8-Chloroquinoline-3-carboxylic acid has garnered interest in medicinal chemistry for its potential applications in drug development, particularly in the treatment of infectious diseases and cancer, owing to its ability to interact with biological targets. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity and environmental impact.

Formula: C₁₀H₆ClNO₂

InChI: InChI=1/C10H6ClNO2/c11-8-3-1-2-6-4-7(10(13)14)5-12-9(6)8/h1-5H,(H,13,14)

SMILES: c1cc2cc(cnc2c(c1)Cl)C(=O)O

Synonyms:

• 3-Quinolinecarboxylic Acid, 8-Chloro-
• 8-CHLOROQUINOLINE-3-CARBOXYLIC ACID

8-Chloroquinoline-3-carboxylic acid

CAS: 71082-54-7

Formula: C₁₀H₆ClNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 207.6131

Ref: IN-DA005EAX

8-Chloroquinoline-3-carboxylic acid

CAS: 71082-54-7

8-Chloroquinoline-3-carboxylic acid

Formula: C₁₀H₆ClNO₂

Purity: ≥95%

Color and Shape: off-white solid

Molecular weight: 207.61g/mol

Ref: 54-OR307837

8-Chloroquinoline-3-carboxylic acid

CAS: 71082-54-7

Formula: C₁₀H₆ClNO₂

Purity: 95%

Molecular weight: 207.61

Ref: 10-F227873

8-Chloroquinoline-3-carboxylic acid

CAS: 71082-54-7

8-Chloroquinoline-3-carboxylic acid is an industrial chemical that is used as a pharmaceutical. It is also an antibacterial agent that has been shown to be effective against sulfite-reducing bacteria, such as Clostridium difficile and Helicobacter pylori. This drug inhibits bacterial growth by damaging the cell membrane and preventing the production of essential proteins for DNA replication. 8-Chloroquinoline-3-carboxylic acid is produced by treating quinoline with chlorination, followed by reaction with sulfuryl chloride or quinoline carboxylic acid.

Formula: C₁₀H₆ClNO₂

Purity: Min. 95%

Molecular weight: 207.61 g/mol

Ref: 3D-WCA08254