
CAS 71083-15-3
:Ethyl 6-(trifluoromethyl)-3-quinolinecarboxylate
Description:
Ethyl 6-(trifluoromethyl)-3-quinolinecarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. The presence of the trifluoromethyl group (-CF3) at the 6-position enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The ethyl ester functional group contributes to its reactivity and solubility properties, allowing for potential applications in organic synthesis and pharmaceutical development. This compound may exhibit unique electronic properties due to the electron-withdrawing nature of the trifluoromethyl group, which can affect its reactivity and interaction with biological targets. Additionally, the compound's structure suggests potential for various substitution reactions, making it a versatile intermediate in the synthesis of more complex molecules. As with many quinoline derivatives, it may also possess interesting pharmacological properties, warranting further investigation in drug discovery contexts. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C13H10F3NO2
InChI:InChI=1S/C13H10F3NO2/c1-2-19-12(18)9-5-8-6-10(13(14,15)16)3-4-11(8)17-7-9/h3-7H,2H2,1H3
InChI key:InChIKey=KRJWXJLZVCUHGT-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC2=C(C=CC(C(F)(F)F)=C2)N=C1
Synonyms:- 3-Quinolinecarboxylic acid, 6-(trifluoromethyl)-, ethyl ester
- Ethyl 6-(trifluoromethyl)-3-quinolinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
