CAS 71083-50-6

8-Methyl-3-quinolinecarbonitrile

Description:

8-Methyl-3-quinolinecarbonitrile is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a methyl group at the 8-position and a cyano group at the 3-position contributes to its unique chemical properties. This compound typically appears as a solid at room temperature and is known for its potential applications in pharmaceuticals and organic synthesis due to its heterocyclic nature. The cyano group (-C≡N) is a notable feature, imparting reactivity that can be exploited in various chemical reactions, such as nucleophilic additions or as a precursor for further functionalization. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important considerations for its practical applications. Safety data should be consulted to understand its handling and toxicity profile.

Formula: C₁₁H₈N₂

InChI: InChI=1S/C11H8N2/c1-8-3-2-4-10-5-9(6-12)7-13-11(8)10/h2-5,7H,1H3

InChI key: InChIKey=GUVMFAWFJCBCHA-UHFFFAOYSA-N

SMILES: CC=1C2=C(C=C(C#N)C=N2)C=CC1

Synonyms:

• 8-Methyl-3-quinolinecarbonitrile
• 3-Quinolinecarbonitrile, 8-methyl-