
CAS 71083-56-2
:7,8-Dimethyl-3-quinolinecarbonitrile
Description:
7,8-Dimethyl-3-quinolinecarbonitrile is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features two methyl groups at the 7 and 8 positions of the quinoline ring, contributing to its unique chemical properties. The presence of a cyano group (-C≡N) at the 3-position enhances its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions and cycloadditions. Typically, compounds like 7,8-Dimethyl-3-quinolinecarbonitrile exhibit moderate to high lipophilicity, which can influence their solubility in organic solvents. Additionally, the compound may display interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which could lead to the discovery of new therapeutic agents. Overall, 7,8-Dimethyl-3-quinolinecarbonitrile is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C12H10N2
InChI:InChI=1S/C12H10N2/c1-8-3-4-11-5-10(6-13)7-14-12(11)9(8)2/h3-5,7H,1-2H3
InChI key:InChIKey=NKEROKRWBRNTLK-UHFFFAOYSA-N
SMILES:CC=1C2=C(C=C(C#N)C=N2)C=CC1C
Synonyms:- 3-Quinolinecarbonitrile, 7,8-dimethyl-
- 7,8-Dimethyl-3-quinolinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.