CAS 71083-59-5

4-oxo-1,4-dihydroquinoline-3-carbonitrile

Description:

4-Oxo-1,4-dihydroquinoline-3-carbonitrile, with the CAS number 71083-59-5, is a heterocyclic organic compound characterized by its quinoline structure, which features a fused benzene and pyridine ring. This compound typically exhibits a yellow to brown color and is known for its potential biological activities, including antimicrobial and anticancer properties. The presence of the carbonitrile group (-C≡N) contributes to its reactivity and ability to participate in various chemical reactions, such as nucleophilic additions. Additionally, the keto group (C=O) in the 4-position enhances its electrophilic character, making it a useful intermediate in organic synthesis. The compound's solubility can vary depending on the solvent, and it may exhibit moderate stability under standard conditions. Its unique structure allows for potential applications in pharmaceuticals and materials science, particularly in the development of novel therapeutic agents. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.

Formula: C₁₀H₆N₂O

InChI: InChI=1/C10H6N2O/c11-5-7-6-12-9-4-2-1-3-8(9)10(7)13/h1-4,6H,(H,12,13)

SMILES: c1ccc2c(c1)c(=O)c(C#N)c[nH]2

Synonyms:

• 3-Quinolinecarbonitrile, 1,4-Dihydro-4-Oxo-
• 3-Quinolinecarbonitrile, 4-Hydroxy-
• 4-Hydroxychinolin-3-carbonitril
• 4-Hydroxyquinoline-3-carbonitrile
• 4-Oxo-1,4-dihydrochinolin-3-carbonitril
• 4-Oxo-1,4-dihydroquinoline-3-carbonitrile

4-oxo-1,4-Dihydroquinoline-3-carbonitrile

CAS: 71083-59-5

4-oxo-1,4-Dihydroquinoline-3-carbonitrile (4ODQ) is a synthetic compound that is acidic in nature. It hydrolyzes in acidic conditions to form a carboxylic acid and ammonia. 4ODQ can also react with amines to form azides, chloride to form chloramines, methyl anthranilate to form piperidines, trifluoride to form triflates, and morpholine to form morpholines. The chemical structure of 4ODQ consists of an anthranilate moiety which has been decarboxylated and an amine group which has been enaminated. 4ODQ inhibits the growth of cancer cells by binding to the ATP binding site on the enzyme kinase B (BRAF), thereby preventing phosphorylation of downstream proteins that are involved in cell proliferation. This inhibition leads to apoptosis or programmed cell death.

Formula: C₁₀H₆N₂O

Purity: Min. 95%

Molecular weight: 170.17 g/mol

Ref: 3D-WCA08359