CymitQuimica logo

CAS 71083-60-8

:

6-fluoro-4-oxo-1H-quinoline-3-carbonitrile

Description:
6-Fluoro-4-oxo-1H-quinoline-3-carbonitrile is a synthetic organic compound characterized by its quinoline core structure, which is a bicyclic aromatic compound containing a nitrogen atom. The presence of a fluorine atom at the 6-position and a carbonitrile group at the 3-position contributes to its unique chemical properties and potential biological activity. The carbonyl group at the 4-position enhances its reactivity, making it a candidate for various chemical transformations. This compound is often studied for its potential applications in medicinal chemistry, particularly as an antimicrobial or anticancer agent, due to the biological significance of quinoline derivatives. Its solubility, stability, and reactivity can vary based on the solvent and conditions used, which is crucial for its application in drug development. Additionally, the compound's molecular structure allows for interactions with biological targets, making it a subject of interest in pharmacological research. Overall, 6-fluoro-4-oxo-1H-quinoline-3-carbonitrile exemplifies the diverse chemistry of heterocyclic compounds and their importance in the development of therapeutic agents.
Formula:C10H5FN2O
InChI:InChI=1/C10H5FN2O/c11-7-1-2-9-8(3-7)10(14)6(4-12)5-13-9/h1-3,5H,(H,13,14)
SMILES:c1cc2c(cc1F)c(=O)c(C#N)c[nH]2
Synonyms:
  • 6-Fluor-4-hydroxychinolin-3-carbonitril
  • 6-Fluor-4-oxo-1,4-dihydrochinolin-3-carbonitril
  • 6-Fluoro-4-Hydroxyquinoline-3-Carbonitrile
  • 6-Fluoro-4-Oxo-1,4-Dihydroquinoline-3-Carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.