CAS 71083-83-5
:5-(hydroxymethyl)-1H-pyrazole-3-carboxamide
Description:
5-(Hydroxymethyl)-1H-pyrazole-3-carboxamide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a hydroxymethyl group (-CH2OH) and a carboxamide group (-C(=O)NH2) attached to the pyrazole ring, contributing to its polar nature and potential for hydrogen bonding. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical applications. The presence of functional groups allows for reactivity in organic synthesis, making it a valuable intermediate in the development of pharmaceuticals and agrochemicals. Additionally, its structural characteristics may impart biological activity, warranting investigation for potential therapeutic uses. As with many pyrazole derivatives, it may exhibit a range of properties, including anti-inflammatory or anti-cancer activities, depending on its specific interactions within biological systems. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C5H7N3O2
InChI:InChI=1/C5H7N3O2/c6-5(10)4-1-3(2-9)7-8-4/h1,9H,2H2,(H2,6,10)(H,7,8)
SMILES:c1c(CO)[nH]nc1C(=O)N
Synonyms:- 1H-Pyrazole-3-carboxamide, 5-(hydroxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
