CymitQuimica logo

CAS 71090-35-2

:

2-nitroethene-1,1-diamine

Description:
2-Nitroethene-1,1-diamine, with the CAS number 71090-35-2, is an organic compound characterized by the presence of both nitro and amine functional groups. This compound features a double bond between the two carbon atoms, which contributes to its reactivity. The nitro group (-NO2) is an electron-withdrawing group, influencing the compound's chemical behavior and making it more susceptible to nucleophilic attack. The presence of two amine groups (-NH2) enhances its potential for hydrogen bonding and increases its solubility in polar solvents. This compound may exhibit properties typical of both alkenes and amines, such as participating in electrophilic addition reactions due to the double bond and acting as a base due to the amine groups. Additionally, 2-nitroethene-1,1-diamine may have applications in organic synthesis and materials science, although specific uses can vary based on its reactivity and stability under different conditions. Safety precautions should be observed when handling this compound, as nitro compounds can be hazardous.
Formula:C2H5N3O2
InChI:InChI=1/C2H5N3O2/c3-2(4)1-5(6)7/h1H,3-4H2
SMILES:C(=C(N)N)N(=O)=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.