CymitQuimica logo

CAS 710941-59-6

:

L-Ribonic acid

Description:
L-Ribonic acid is a sugar acid derived from ribose, characterized by its structure that includes a carboxylic acid functional group attached to the ribose backbone. It is a pentose monosaccharide, meaning it contains five carbon atoms, and is an important intermediate in various biochemical pathways. The presence of the carboxylic acid group imparts acidic properties to the molecule, allowing it to participate in various chemical reactions, including esterification and oxidation. L-Ribonic acid is typically found in its D- and L- forms, with the L-form being less common in nature. Its CAS number, 710941-59-6, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases. This compound has potential applications in biochemistry and pharmaceuticals, particularly in the synthesis of nucleosides and nucleotides, as well as in the study of metabolic pathways involving ribose derivatives. Overall, L-Ribonic acid is a significant compound in the realm of carbohydrate chemistry and biochemistry.
Formula:C5H10O6
InChI:InChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/t2-,3-,4-/m0/s1
InChI key:InChIKey=QXKAIJAYHKCRRA-HZLVTQRSSA-N
SMILES:[C@@H]([C@@H](C(O)=O)O)([C@H](CO)O)O
Synonyms:
  • L-(+)-Ribonic acid
  • L-Ribonic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.