CAS 710943-30-9

1-[(2R)-2-Pyrrolidinylmethyl]-1H-imidazole

Description:

1-[(2R)-2-Pyrrolidinylmethyl]-1H-imidazole is a chemical compound characterized by its unique structural features, which include an imidazole ring and a pyrrolidine moiety. The imidazole ring is a five-membered heterocyclic structure containing two nitrogen atoms, contributing to the compound's potential biological activity. The presence of the pyrrolidine group, which is a saturated five-membered ring containing one nitrogen atom, suggests that the compound may exhibit properties relevant to medicinal chemistry, particularly in the context of drug design and development. This compound is often studied for its potential interactions with biological targets, including receptors and enzymes, due to the presence of both basic and nucleophilic sites in its structure. Its stereochemistry, indicated by the (2R) configuration, may influence its pharmacological properties and interactions. Overall, 1-[(2R)-2-Pyrrolidinylmethyl]-1H-imidazole represents a class of compounds that may have applications in various fields, including pharmaceuticals and biochemistry, warranting further investigation into its properties and potential uses.

Formula: C₈H₁₃N₃

InChI: InChI=1S/C8H13N3/c1-2-8(10-3-1)6-11-5-4-9-7-11/h4-5,7-8,10H,1-3,6H2/t8-/m1/s1

InChI key: InChIKey=VLNMFRPPGPXJHP-MRVPVSSYSA-N

SMILES: C([C@H]1CCCN1)N2C=CN=C2

Synonyms:

• (R)-1-(Pyrrolidin-2-ylmethyl)-1H-imidazole
• 1-[(2R)-2-Pyrrolidinylmethyl]-1H-imidazole
• 1-[[(2R)-Pyrrolidin-2-yl]methyl]-1H-imidazole
• 1H-Imidazole,1-[(2R)-2-pyrrolidinylmethyl]-(9CI)
• 1H-Imidazole, 1-[(2R)-2-pyrrolidinylmethyl]-