
CAS 71095-24-4
:1-(2-Bromo-5-methoxyphenyl)-1-propanone
Description:
1-(2-Bromo-5-methoxyphenyl)-1-propanone, with the CAS number 71095-24-4, is an organic compound characterized by its structure, which includes a brominated aromatic ring and a ketone functional group. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the bromine atom enhances its reactivity, making it useful in various substitution reactions. The methoxy group contributes to the compound's electronic properties, influencing its reactivity and solubility in organic solvents. Additionally, the ketone functional group is significant for its role in various chemical reactions, including nucleophilic additions. Safety data sheets should be consulted for handling precautions, as halogenated compounds can pose health risks. Overall, 1-(2-Bromo-5-methoxyphenyl)-1-propanone is a valuable compound in research and development, particularly in the synthesis of more complex organic molecules.
Formula:C10H11BrO2
InChI:InChI=1S/C10H11BrO2/c1-3-10(12)8-6-7(13-2)4-5-9(8)11/h4-6H,3H2,1-2H3
InChI key:InChIKey=BYYWNAWJNHTCHE-UHFFFAOYSA-N
SMILES:C(CC)(=O)C1=CC(OC)=CC=C1Br
Synonyms:- 1-Propanone, 1-(2-bromo-5-methoxyphenyl)-
- 1-(2-Bromo-5-methoxyphenyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.