CAS 71095-26-6

1-(6-bromo-1,3-benzodioxol-5-yl)ethanone

Description:

1-(6-bromo-1,3-benzodioxol-5-yl)ethanone, with the CAS number 71095-26-6, is an organic compound characterized by its unique structure, which includes a benzodioxole moiety substituted with a bromine atom and an ethanone functional group. This compound typically exhibits properties associated with both aromatic and carbonyl functionalities, contributing to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic character, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the benzodioxole structure is known for its biological activity, which may suggest potential pharmacological applications. The compound is likely to be soluble in organic solvents, and its stability can be influenced by environmental factors such as light and temperature. As with many halogenated compounds, safety precautions should be taken when handling it due to potential toxicity and environmental impact. Overall, 1-(6-bromo-1,3-benzodioxol-5-yl)ethanone represents a versatile building block in synthetic organic chemistry.

Formula: C₉H₇BrO₃

InChI: InChI=1/C9H7BrO3/c1-5(11)6-2-8-9(3-7(6)10)13-4-12-8/h2-3H,4H2,1H3