CymitQuimica logo

CAS 71096-80-5

:

N-[(E)-3,4-dihydro-2H-pyran-2-ylmethylidene]aniline

Description:
N-[(E)-3,4-dihydro-2H-pyran-2-ylmethylidene]aniline, with the CAS number 71096-80-5, is an organic compound characterized by its unique structure that combines an aniline moiety with a substituted pyran ring. This compound features a double bond configuration (E) at the pyran ring, indicating a specific geometric arrangement that can influence its reactivity and interactions. The presence of the aniline group suggests potential applications in dye synthesis, pharmaceuticals, or as a building block in organic synthesis due to its ability to participate in various chemical reactions, such as electrophilic aromatic substitution. Additionally, the dihydropyran component may impart properties related to cyclic ether chemistry, including potential solubility in organic solvents and reactivity towards nucleophiles. The compound's characteristics, including its melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups, making it a subject of interest in both synthetic and medicinal chemistry.
Formula:C12H13NO
InChI:InChI=1/C12H13NO/c1-2-6-11(7-3-1)13-10-12-8-4-5-9-14-12/h1-3,5-7,9-10,12H,4,8H2/b13-10+
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.