CAS 710966-54-4

2-[(2-fluorobenzyl)sulfanyl]aniline

Description:

2-[(2-Fluorobenzyl)sulfanyl]aniline is an organic compound characterized by the presence of both an aniline group and a sulfanyl (thioether) moiety. The structure features a fluorobenzyl group attached to a sulfur atom, which is further connected to an aniline structure. This compound typically exhibits properties associated with both aromatic and sulfur-containing compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the aniline nitrogen and the sulfur atom. The fluorine substituent can influence the compound's electronic properties, potentially enhancing its reactivity or altering its interaction with biological targets. Additionally, the presence of the sulfanyl group may impart unique characteristics, such as increased lipophilicity or specific binding interactions in biological systems. Overall, 2-[(2-fluorobenzyl)sulfanyl]aniline may be of interest in medicinal chemistry and materials science due to its structural features and potential applications in drug development or as a building block in organic synthesis.

Formula: C₁₃H₁₂FNS

InChI: InChI=1/C13H12FNS/c14-11-6-2-1-5-10(11)9-16-13-8-4-3-7-12(13)15/h1-8H,9,15H2

SMILES: c1ccc(c(c1)CSc1ccccc1N)F