CAS 710967-01-4
:2-[(3-methylbenzyl)sulfanyl]aniline
Description:
2-[(3-Methylbenzyl)sulfanyl]aniline, identified by its CAS number 710967-01-4, is an organic compound characterized by the presence of an aniline group substituted with a sulfanyl (thioether) moiety and a 3-methylbenzyl group. This compound features a sulfur atom bonded to a benzyl group, which contributes to its unique chemical properties. The presence of the aniline structure imparts basicity due to the amino group, making it capable of participating in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The methyl group on the benzyl ring can influence the compound's steric and electronic properties, potentially affecting its reactivity and solubility. Additionally, the sulfanyl group can enhance the compound's ability to form coordination complexes with metals. Overall, 2-[(3-methylbenzyl)sulfanyl]aniline is of interest in organic synthesis and may have applications in pharmaceuticals or materials science due to its functional groups and structural characteristics.
Formula:C14H15NS
InChI:InChI=1/C14H15NS/c1-11-5-4-6-12(9-11)10-16-14-8-3-2-7-13(14)15/h2-9H,10,15H2,1H3
SMILES:Cc1cccc(c1)CSc1ccccc1N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.