
CAS 71097-53-5
:4-(5-Methyl-2-furanyl)-2-pentanone
Description:
4-(5-Methyl-2-furanyl)-2-pentanone, with the CAS number 71097-53-5, is an organic compound characterized by its unique structure that includes a furan ring and a ketone functional group. This compound features a five-membered aromatic ring containing oxygen, which contributes to its reactivity and potential applications in organic synthesis. The presence of the methyl group on the furan ring enhances its stability and influences its chemical behavior. As a ketone, it exhibits typical properties such as being a polar solvent and participating in nucleophilic addition reactions. The compound is likely to have a distinctive odor, which is common among many furan derivatives, and may be utilized in flavoring or fragrance applications. Additionally, its structural characteristics suggest potential uses in pharmaceuticals or agrochemicals, although specific applications would depend on further research into its biological activity and safety profile. Overall, 4-(5-Methyl-2-furanyl)-2-pentanone represents a versatile compound with interesting chemical properties.
Formula:C10H14O2
InChI:InChI=1S/C10H14O2/c1-7(6-8(2)11)10-5-4-9(3)12-10/h4-5,7H,6H2,1-3H3
InChI key:InChIKey=SNCJRRZMGMKMBW-UHFFFAOYSA-N
SMILES:C(CC(C)=O)(C)C=1OC(C)=CC1
Synonyms:- 2-Pentanone, 4-(5-methyl-2-furanyl)-
- 2-Pentanone, 4-(5-methyl-2-furyl)-
- 4-(5-Methyl-2-furanyl)-2-pentanone
- 2-(1-Methyl-3-oxobutyl)-5-methylfuran
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.