CAS 710980-14-6
:5-(3-Benzyloxyphenyl)-1H-tetrazole
Description:
5-(3-Benzyloxyphenyl)-1H-tetrazole is an organic compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. This compound features a phenyl group substituted with a benzyloxy moiety, enhancing its lipophilicity and potential for biological activity. The presence of the tetrazole ring often imparts unique properties, such as increased stability and the ability to participate in hydrogen bonding, making it of interest in medicinal chemistry. The compound may exhibit various pharmacological activities, including anti-inflammatory or antimicrobial effects, due to its structural characteristics. Its CAS number, 710980-14-6, allows for precise identification in chemical databases. As with many organic compounds, its solubility, melting point, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 5-(3-Benzyloxyphenyl)-1H-tetrazole represents a versatile scaffold for further chemical modifications and potential applications in drug development.
Formula:C14H12N4O
InChI:InChI=1/C14H12N4O/c1-2-5-11(6-3-1)10-19-13-8-4-7-12(9-13)14-15-17-18-16-14/h1-9H,10H2,(H,15,16,17,18)
SMILES:c1ccc(cc1)COc1cccc(c1)c1n[nH]nn1
Synonyms:- 5-[3-(benzyloxy)phenyl]-2H-tetrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

