CAS 711-01-3
:Tricyclo(3.3.1.13,7)decane-1-carboxylic acid, methyl ester
Description:
Tricyclo(3.3.1.1^3,7)decane-1-carboxylic acid, methyl ester, commonly referred to as methyl tricyclodecanecarboxylate, is an organic compound characterized by its unique tricyclic structure. This compound features a carboxylic acid functional group esterified with a methyl group, contributing to its reactivity and solubility properties. The tricyclic framework imparts rigidity and influences the compound's physical properties, such as boiling and melting points, which are typically higher than those of more flexible molecules. Methyl tricyclodecanecarboxylate is generally a colorless to pale yellow liquid with a pleasant odor, making it potentially useful in flavor and fragrance applications. Its chemical stability and low volatility can also make it suitable for use in various chemical syntheses and as an intermediate in organic reactions. Additionally, the compound's structure may exhibit interesting stereochemical properties, which can affect its interactions in biological systems. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C12H18O2
InChI:InChI=1/C12H18O2/c1-14-11(13)12-5-8-2-9(6-12)4-10(3-8)7-12/h8-10H,2-7H2,1H3
SMILES:COC(=O)C12CC3CC(CC(C3)C2)C1
Synonyms:- 1-Adamantanecarboxylic acid, methyl ester
- Adamantan-1-carboxylic acid, methyl ester
- Methyl adamantane-1-carboxylate
- Tricyclo[3.3.1.1~3,7~]Decane-1-Carboxylic Acid, Methyl Ester
- Methyl Tricyclo[3.3.1.1~3,7~]Decane-1-Carboxylate
- Adamantane-1-carboxylic acid methyl ester
- 1-Adamantyl Carboxylic Acid Methyl Ester
- Methyl 1-Adamantane Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Adamantane-1-carboxylic acid methyl ester
CAS:Formula:C12H18O2Purity:97%Color and Shape:SolidMolecular weight:194.2701Methyl adamantane-1-carboxylate
CAS:Methyl adamantane-1-carboxylatePurity:98%Molecular weight:194.27g/molMethyl 1-Adamantanecarboxylate
CAS:Formula:C12H18O2Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:194.271-Adamantanecarboxylic acid methyl ester
CAS:<p>1-Adamantanecarboxylic acid methyl ester is a specialized chemical compound, classified as an ester derivative from the adamantane structure. It is sourced through the esterification of 1-adamantanecarboxylic acid, often involving methanol as a reagent under catalyzed conditions. The compound's mode of action is primarily as an intermediate in organic synthesis, where it enables the introduction of adamantyl groups into target molecules, influencing molecular structure with its bulky, rigid framework.This ester derivative finds extensive application in the realm of synthetic organic chemistry. It serves as a crucial intermediate in the development of complex organic materials and pharmaceuticals, where the adamantane moiety is required to confer specific steric and electronic properties. The incorporation of adamantane from 1-adamantanecarboxylic acid methyl ester can enhance the thermal stability, lipophilicity, and rigidity of the resultant compounds, making it invaluable for researchers focused on material sciences and drug development. Its versatile reactivity and robust structure make it a sought-after compound for advancing chemical research and innovation.</p>Formula:C12H18O2Purity:Min. 98%Color and Shape:White PowderMolecular weight:194.27 g/molMethyl adamantane-1-carboxylate
CAS:Formula:C12H18O2Purity:98%Color and Shape:Solid, White to very pale yellow powderMolecular weight:194.2741-Adamantanecarboxylic Acid Methyl Ester
CAS:Controlled Product<p>Applications A derivative of 1-Adamantanecarboxylic Acid.<br></p>Formula:C12H18O2Color and Shape:NeatMolecular weight:194.27





