CAS 711-79-5: 2-Acetyl-1-naphthol
Description:2-Acetyl-1-naphthol, with the CAS number 711-79-5, is an organic compound that belongs to the class of naphthol derivatives. It features a naphthalene ring substituted with an acetyl group and a hydroxyl group, which contributes to its unique chemical properties. This compound typically appears as a solid, often in a crystalline form, and is characterized by its aromatic structure, which imparts stability and distinct reactivity. It is known for its solubility in organic solvents, while being less soluble in water due to its hydrophobic naphthalene core. 2-Acetyl-1-naphthol exhibits properties such as fluorescence and can participate in various chemical reactions, including electrophilic substitutions and condensation reactions. It is utilized in organic synthesis, particularly in the production of dyes, pharmaceuticals, and as an intermediate in various chemical processes. Additionally, its derivatives may exhibit biological activity, making it of interest in medicinal chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C12H10O2
InChI:InChI=1S/C12H10O2/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-7,14H,1H3
InChI key:InChIKey=JBGJVMVWYWUVOW-UHFFFAOYSA-N
SMILES:O=C(C=1C=CC=2C=CC=CC2C1O)C
- Synonyms:
- 1-(1-Hydroxy-2-naphthalenyl)ethanone
- 1-(1-Hydroxynaphthalen-2-yl)ethan-1-one
- 1-Hydroxy-2-acetonaphthone
- 1-Hydroxy-2-acetylnaphthalene
- 1-Hydroxy-2-naphthyl methyl ketone
- 1′-Hydroxy-2-acetonapthone
- 2-Aceto-1-naphthol
- 2-Acetonaphthone, 1-hydroxy-
- 2-Acetyl-1-hydroxynaphthalene
- 2-Acetyl-1-naphthalenol
- See more synonyms
- Ethanone, 1-(1-hydroxy-2-naphthalenyl)-
- NSC 4973
- 2-Acetyl-1-naphthol
