CAS 711007-44-2
:2,3-Diaminobenzamide
Description:
2,3-Diaminobenzamide is an organic compound characterized by the presence of two amino groups (-NH2) and a benzamide functional group. It features a benzene ring with amino substituents located at the 2 and 3 positions relative to the amide group. This compound is typically a white to off-white solid and is soluble in polar solvents due to its ability to form hydrogen bonds. The presence of the amino groups contributes to its basicity and potential reactivity, making it useful in various chemical reactions, including those involving nucleophilic substitutions. 2,3-Diaminobenzamide can serve as a building block in the synthesis of pharmaceuticals and agrochemicals, and it may exhibit biological activity, which warrants further investigation. Its CAS number, 711007-44-2, is a unique identifier that facilitates its identification in chemical databases. As with many amines, it may be sensitive to oxidation and should be handled with care in laboratory settings.
Formula:C7H9N3O
InChI:InChI=1/C7H9N3O/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,8-9H2,(H2,10,11)
SMILES:c1cc(c(c(c1)N)N)C(=N)O
Synonyms:- Benzamide, 2,3-Diamino-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3-Diaminobenzamide
CAS:2,3-Diaminobenzamide is a synthetic aromatic compound that is used as a radiation stabilizer. It is also an effective antimicrobial agent with reactive properties against bacteria and fungi. 2,3-Diaminobenzamide has been shown to have anti-cancer properties and can be used to treat inflammatory diseases such as rheumatoid arthritis or ulcerative colitis. The intramolecular hydrogen bond between the amide group and the benzene ring in 2,3-diaminobenzamide contributes to its stability and biological activity.
Formula:C7H9N3OPurity:Min. 95%Color and Shape:PowderMolecular weight:151.17 g/mol



