CAS 711017-67-3

5-Chloro-2,3-dihydro-1H-indene-1-methanol

Description:

5-Chloro-2,3-dihydro-1H-indene-1-methanol is an organic compound characterized by its unique bicyclic structure, which includes a chloro substituent and a hydroxymethyl group. This compound features a fused indene ring system, contributing to its potential reactivity and interaction with biological systems. The presence of the chlorine atom introduces electronegativity, which can influence the compound's polarity and solubility in various solvents. The hydroxymethyl group enhances the compound's ability to participate in hydrogen bonding, affecting its physical properties such as boiling and melting points. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and characterization typically involve standard organic reactions, and it may be utilized in various applications, including as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₁₀H₁₁ClO

InChI: InChI=1S/C10H11ClO/c11-9-3-4-10-7(5-9)1-2-8(10)6-12/h3-5,8,12H,1-2,6H2

InChI key: InChIKey=KGSCXMZIJZUPBW-UHFFFAOYSA-N

SMILES: C(O)C1C=2C(CC1)=CC(Cl)=CC2

Synonyms:

• (5-Chloro-indan-1-yl)-methanol
• 1H-Indene-1-methanol, 5-chloro-2,3-dihydro-
• 5-Chloro-2,3-dihydro-1H-indene-1-methanol