CAS 711019-86-2

N',N'''-butane-1,4-diylbis[1-(3-isothiocyanatophenyl)(thiourea)]

Description:

N',N'''-butane-1,4-diylbis[1-(3-isothiocyanatophenyl)(thiourea)], with CAS number 711019-86-2, is a chemical compound characterized by its unique structure that includes a butane backbone and two thiourea moieties, each substituted with an isothiocyanate group. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and materials science, due to its potential biological activity and ability to form coordination complexes. The presence of isothiocyanate groups suggests that it may exhibit reactivity towards nucleophiles, making it useful in various synthetic applications. Additionally, thiourea derivatives are known for their diverse biological properties, including antimicrobial and anticancer activities. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, N',N'''-butane-1,4-diylbis[1-(3-isothiocyanatophenyl)(thiourea)] represents a class of compounds with significant potential for further exploration in chemical and biological research.

Formula: C₂₀H₂₀N₆S₄

InChI: InChI=1/C20H20N6S4/c27-13-23-15-5-3-7-17(11-15)25-19(29)21-9-1-2-10-22-20(30)26-18-8-4-6-16(12-18)24-14-28/h3-8,11-12H,1-2,9-10H2,(H2,21,25,29)(H2,22,26,30)

SMILES: C(CCN=C(Nc1cccc(c1)N=C=S)S)CN=C(Nc1cccc(c1)N=C=S)S

MRS 2578

CAS: 711019-86-2

MRS 2578

Purity: ≥95%

Molecular weight: 472.67g/mol

Ref: 54-BUP13254

1,1'-(Butane-1,4-Diyl)Bis(3-(3-Isothiocyanatophenyl)Thiourea)

CAS: 711019-86-2

1,1'-(Butane-1,4-Diyl)Bis(3-(3-Isothiocyanatophenyl)Thiourea)

Purity: 98%

Molecular weight: 472.67g/mol

Ref: 54-OR1023146

MRS 2578

CAS: 711019-86-2

Formula: C₂₀H₂₀N₆S₄

Molecular weight: 472.67

Ref: 7W-GL1193

MRS 2578

CAS: 711019-86-2

MRS2578, an effective P2Y6 receptor antagonist with IC50 of 37 nM, shows insignificant inhibition at P2Y1, P2Y2, P2Y4, and P2Y11 receptors.

Formula: C₂₀H₂₀N₆S₄

Purity: 97.58% - 99.73%

Color and Shape: White Solid

Molecular weight: 472.67

Ref: TM-T6172

1,1′-(Butane-1,4-diyl)bis(3-(3-isothiocyanatophenyl)thiourea)

CAS: 711019-86-2

Purity: 98%

Molecular weight: 472.6600037

Ref: 10-F868959

MRS 2578

Controlled Product

CAS: 711019-86-2

Applications MRS 2578 is a selective P2Y66 receptor antagonist.

Formula: C₂₀H₂₀N₆S₄

Color and Shape: Neat

Molecular weight: 472.67

Ref: TR-M750213