CymitQuimica logo

CAS 71112-91-9

:

1,1'-disulfanediylbis(2-bromobenzene)

Description:
1,1'-Disulfanediylbis(2-bromobenzene), with the CAS number 71112-91-9, is an organosulfur compound characterized by the presence of two bromobenzene groups connected by a disulfide linkage. This compound features a central disulfide (-S-S-) bond, which is a key structural element that imparts unique chemical properties, such as the ability to undergo redox reactions. The bromobenzene moieties contribute to the compound's reactivity, particularly in nucleophilic substitution reactions due to the presence of the bromine atom, which is a good leaving group. Additionally, the aromatic nature of the bromobenzene rings provides stability and influences the compound's solubility and interaction with other chemical species. The presence of sulfur in the structure can also lead to interesting coordination chemistry and potential applications in materials science and organic synthesis. Overall, 1,1'-disulfanediylbis(2-bromobenzene) is a versatile compound with potential utility in various chemical applications.
Formula:C12H8Br2S2
InChI:InChI=1/C12H8Br2S2/c13-9-5-1-3-7-11(9)15-16-12-8-4-2-6-10(12)14/h1-8H
SMILES:c1ccc(c(c1)Br)SSc1ccccc1Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.