CAS 71125-48-9
:5-(4-Methyl-1-piperidinyl)-1,3,4-thiadiazol-2-amine
Description:
5-(4-Methyl-1-piperidinyl)-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a piperidine moiety. This compound typically exhibits properties associated with both heterocyclic and amine functionalities, contributing to its potential biological activity. The presence of the thiadiazole ring suggests it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The piperidine group can influence the compound's solubility and interaction with biological systems, potentially enhancing its pharmacological properties. Additionally, the methyl group on the piperidine ring may affect the steric and electronic properties, influencing its reactivity and binding affinity in biological contexts. Overall, this compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in areas targeting specific receptors or enzymes. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C8H14N4S
InChI:InChI=1S/C8H14N4S/c1-6-2-4-12(5-3-6)8-11-10-7(9)13-8/h6H,2-5H2,1H3,(H2,9,10)
InChI key:InChIKey=PFDMUJUXOAJIRU-UHFFFAOYSA-N
SMILES:NC=1SC(N2CCC(C)CC2)=NN1
Synonyms:- 1,3,4-Thiadiazol-2-amine, 5-(4-methyl-1-piperidinyl)-
- 5-(4-Methyl-1-piperidinyl)-1,3,4-thiadiazol-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.