CymitQuimica logo

CAS 71125-50-3

:

5-(4-Methyl-1-piperazinyl)-1,3,4-thiadiazol-2-amine

Description:
5-(4-Methyl-1-piperazinyl)-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a piperazine moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the piperazine group, which is known for its role in pharmacology. The thiadiazole ring contributes to its chemical reactivity and may influence its solubility and stability. The presence of the methyl group on the piperazine enhances its lipophilicity, potentially affecting its interaction with biological targets. This compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in areas such as antimicrobial or antitumor research. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be analyzed using methods such as NMR, mass spectrometry, and chromatography to confirm its structure and purity. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C7H13N5S
InChI:InChI=1S/C7H13N5S/c1-11-2-4-12(5-3-11)7-10-9-6(8)13-7/h2-5H2,1H3,(H2,8,9)
InChI key:InChIKey=RIHRWRZTPNBBAS-UHFFFAOYSA-N
SMILES:NC=1SC(N2CCN(C)CC2)=NN1
Synonyms:
  • 5-(4-Methylpiperazin-1-yl)-1,3,4-thiadiazol-2-amine
  • 5-(4-Methyl-1-piperazinyl)-1,3,4-thiadiazol-2-amine
  • [5-(4-Methylpiperazin-1-yl)-[1,3,4]thiadiazol-2-yl]amine
  • 1,3,4-Thiadiazol-2-amine, 5-(4-methyl-1-piperazinyl)-
  • 2-Amino-5-(4-methyl-1-piperazinyl)-1,3,4-thiadiazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.