CAS 71125-54-7

N2,N2-Dipropyl-1,3,4-thiadiazole-2,5-diamine

Description:

N2,N2-Dipropyl-1,3,4-thiadiazole-2,5-diamine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and two propyl groups attached to the nitrogen atoms. This compound is part of a class of heterocyclic compounds that often exhibit interesting biological and chemical properties. The presence of the thiadiazole moiety suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The diamine functional groups can participate in various chemical reactions, including condensation and substitution reactions, making it versatile in synthetic chemistry. Additionally, the propyl groups may influence the solubility and stability of the compound in different solvents. While specific physical properties such as melting point, boiling point, and solubility are not detailed here, compounds of this nature typically exhibit moderate to low solubility in water and may be more soluble in organic solvents. Overall, N2,N2-Dipropyl-1,3,4-thiadiazole-2,5-diamine presents a range of potential applications due to its structural characteristics.

Formula: C₈H₁₆N₄S

InChI: InChI=1S/C8H16N4S/c1-3-5-12(6-4-2)8-11-10-7(9)13-8/h3-6H2,1-2H3,(H2,9,10)

InChI key: InChIKey=YLWSJFFPTIJNRS-UHFFFAOYSA-N

SMILES: N(CCC)(CCC)C1=NN=C(N)S1

Synonyms:

• 1,3,4-Thiadiazole-2,5-diamine, N2,N2-dipropyl-
• 1,3,4-Thiadiazole-2,5-diamine, N,N-dipropyl-
• N2,N2-Dipropyl-1,3,4-thiadiazole-2,5-diamine
• 2-Amino-5-(dipropylamino)-1,3,4-thiadiazole
• 2-N,2-N-Dipropyl-1,3,4-thiadiazole-2,5-diamine