CAS 71133-22-7
:4(3H)-Pyrimidinone, 5-methoxy-
Description:
4(3H)-Pyrimidinone, 5-methoxy- is a heterocyclic organic compound characterized by a pyrimidine ring structure, which is a six-membered ring containing two nitrogen atoms at positions 1 and 3. This compound features a methoxy group (-OCH3) at the 5-position of the pyrimidinone ring, which contributes to its chemical properties and reactivity. It is typically a white to off-white solid and is soluble in polar organic solvents. The presence of the methoxy group can influence the compound's biological activity, making it of interest in pharmaceutical research. Pyrimidinones are known for their role in various biological processes and can serve as intermediates in the synthesis of more complex molecules. The compound's CAS number, 71133-22-7, allows for its identification in chemical databases and literature. Overall, 4(3H)-Pyrimidinone, 5-methoxy- is a compound of interest in medicinal chemistry and may exhibit various pharmacological activities.
Formula:C5H6N2O2
InChI:InChI=1S/C5H6N2O2/c1-9-4-2-6-3-7-5(4)8/h2-3H,1H3,(H,6,7,8)
InChI key:InChIKey=WOKGGVGWBXBJPK-UHFFFAOYSA-N
SMILES:O(C)C=1C(=O)NC=NC1
Synonyms:- 4(3H)-Pyrimidinone, 5-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
