
CAS 71154-34-2
:2-Cyano-3-thiophenecarboxylic acid
Description:
2-Cyano-3-thiophenecarboxylic acid is an organic compound characterized by the presence of both a cyano group (-CN) and a carboxylic acid group (-COOH) attached to a thiophene ring. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid functional group. The thiophene ring contributes to its aromatic properties, which can influence its reactivity and stability. The cyano group enhances the compound's electron-withdrawing characteristics, making it useful in various chemical reactions, including nucleophilic substitutions and as a building block in organic synthesis. Additionally, 2-Cyano-3-thiophenecarboxylic acid may exhibit biological activity, making it of interest in pharmaceutical research. Its unique structure allows for potential applications in materials science, particularly in the development of organic semiconductors and dyes. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C6H3NO2S
InChI:InChI=1S/C6H3NO2S/c7-3-5-4(6(8)9)1-2-10-5/h1-2H,(H,8,9)
InChI key:InChIKey=KINIFPQVNPZWGY-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C(O)=O)C=CS1
Synonyms:- 2-Cyano-3-thiophenecarboxylic acid
- 3-Thiophenecarboxylic acid, 2-cyano-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.