CAS 71155-07-2

stereoisomer of 5-Oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid

Description:

The chemical substance known as the stereoisomer of 5-Oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid, with the CAS number 71155-07-2, is characterized by its unique tricyclic structure, which includes a ketone functional group and a carboxylic acid group. This compound exhibits stereoisomerism, meaning it can exist in different spatial arrangements that affect its chemical properties and biological activity. The presence of the carboxylic acid group contributes to its acidity and potential reactivity in various chemical reactions, while the tricyclic framework provides rigidity and influences its interaction with biological targets. The stereochemistry of the molecule can significantly impact its pharmacological properties, making it relevant in medicinal chemistry. Additionally, its structural complexity may lead to interesting physical properties, such as solubility and melting point, which are important for its applications in research and industry. Overall, this compound represents a fascinating example of how molecular structure can dictate chemical behavior and potential applications.

Formula: C₈H₈O₃

InChI: InChI=1S/C8H8O3/c9-7-3-1-2-4(5(2)7)6(3)8(10)11/h2-6H,1H2,(H,10,11)/t2-,3+,4+,5-,6-/m1/s1

InChI key: InChIKey=YUOZAHBGIJALKD-FPRJBGLDSA-N

SMILES: C(O)(=O)[C@H]1[C@@]2([C@]3([C@@]2(C[C@@]1(C3=O)[H])[H])[H])[H]

Synonyms:

• stereoisomer of 5-Oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid
• Tricyclo[2.2.1.02,6]heptane-3-carboxylic acid, 5-oxo-, stereoisomer
• (1R,2S,3S,4S,6R)-5-Oxotricyclo[2.2.1.02,6]heptane-3-carboxylic Acid

(1R,2S,3S,4S,6R)-5-Oxotricyclo[2.2.1.02,6]heptane-3-carboxylic Acid

CAS: 71155-07-2

Formula: C₈H₈O₃

Molecular weight: 152.1473

Ref: IN-DA00IC5E

(1R,2S,3S,4S,6R)-5-Oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid

CAS: 71155-07-2

(1R,2S,3S,4S,6R)-5-Oxotricyclo[2.2.1.02,6]heptane-3-carboxylic acid

Purity: ≥95%

Molecular weight: 152.15g/mol

Ref: 54-OR470728